C23H33N3O3 — CID 110200185
N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]cyclohexanecarboxamide (PubChem CID 110200185) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110200185 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]cyclohexanecarboxamide |
| SMILES | O=C1CC(c2ccccc2)N(C(=O)CNC(=O)C2CCCCC2)CCCCCN1 |
| InChI | InChI=1S/C23H33N3O3/c27-21-16-20(18-10-4-1-5-11-18)26(15-9-3-8-14-24-21)22(28)17-25-23(29)19-12-6-2-7-13-19/h1,4-5,10-11,19-20H,2-3,6-9,12-17H2,(H,24,27)(H,25,29) |
| InChIKey | WDWRSFQKLXUGEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |