C23H28N4O3 — CID 110200231
N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2-pyridin-4-ylacetamide (PubChem CID 110200231) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2-pyridin-4-ylacetamide.
| Compound Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 110200231 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2-pyridin-4-ylacetamide |
| SMILES | O=C(Cc1ccncc1)NCC(=O)N1CCCCCNC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C23H28N4O3/c28-21(15-18-9-12-24-13-10-18)26-17-23(30)27-14-6-2-5-11-25-22(29)16-20(27)19-7-3-1-4-8-19/h1,3-4,7-10,12-13,20H,2,5-6,11,14-17H2,(H,25,29)(H,26,28) |
| InChIKey | ADRJEAWUSNIGLA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |