C22H27N3O4 — CID 110202267
N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazacycloundec-1-yl)ethyl]furan-2-carboxamide (PubChem CID 110202267) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazacycloundec-1-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazacycloundec-1-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110202267 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazacycloundec-1-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C1CC(c2ccccc2)N(C(=O)CNC(=O)c2ccco2)CCCCCCN1 |
| InChI | InChI=1S/C22H27N3O4/c26-20-15-18(17-9-4-3-5-10-17)25(13-7-2-1-6-12-23-20)21(27)16-24-22(28)19-11-8-14-29-19/h3-5,8-11,14,18H,1-2,6-7,12-13,15-16H2,(H,23,26)(H,24,28) |
| InChIKey | UONNDMIXXUPRQF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |