C23H27FN2O3 — CID 110202191
5-[2-(4-fluorophenoxy)acetyl]-4-phenyl-1,5-diazacycloundecan-2-one (PubChem CID 110202191) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is 5-[2-(4-fluorophenoxy)acetyl]-4-phenyl-1,5-diazacycloundecan-2-one.
| Compound Name | 5-[2-(4-fluorophenoxy)acetyl]-4-phenyl-1,5-diazacycloundecan-2-one |
|---|---|
| PubChem CID | 110202191 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 5-[2-(4-fluorophenoxy)acetyl]-4-phenyl-1,5-diazacycloundecan-2-one |
| SMILES | O=C1CC(c2ccccc2)N(C(=O)COc2ccc(F)cc2)CCCCCCN1 |
| InChI | InChI=1S/C23H27FN2O3/c24-19-10-12-20(13-11-19)29-17-23(28)26-15-7-2-1-6-14-25-22(27)16-21(26)18-8-4-3-5-9-18/h3-5,8-13,21H,1-2,6-7,14-17H2,(H,25,27) |
| InChIKey | GSWHRRCZBYAUFI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |