C17H23ClN2OS — CID 119937739
1-[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone (PubChem CID 119937739) has the molecular formula C17H23ClN2OS and a molecular weight of 338.90 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 119937739 |
| Molecular Formula | C17H23ClN2OS |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone |
| SMILES | O=C(CC1CSCCN1)N1CCCC1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN2OS/c18-16-6-2-1-4-13(16)10-15-5-3-8-20(15)17(21)11-14-12-22-9-7-19-14/h1-2,4,6,14-15,19H,3,5,7-12H2 |
| InChIKey | LJYSFKCBBQANEQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |