C14H17ClN2OS — CID 119939299
1-(4-chloro-2,3-dihydroindol-1-yl)-2-thiomorpholin-3-ylethanone (PubChem CID 119939299) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is 1-(4-chloro-2,3-dihydroindol-1-yl)-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-(4-chloro-2,3-dihydroindol-1-yl)-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 119939299 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(4-chloro-2,3-dihydroindol-1-yl)-2-thiomorpholin-3-ylethanone |
| SMILES | O=C(CC1CSCCN1)N1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C14H17ClN2OS/c15-12-2-1-3-13-11(12)4-6-17(13)14(18)8-10-9-19-7-5-16-10/h1-3,10,16H,4-9H2 |
| InChIKey | MSTOIZWRJSRBSD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |