C17H21ClFN3O2S — CID 119938052
1-[4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone (PubChem CID 119938052) has the molecular formula C17H21ClFN3O2S and a molecular weight of 385.89 g/mol. Its IUPAC name is 1-[4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-[4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 119938052 |
| Molecular Formula | C17H21ClFN3O2S |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-[4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone |
| SMILES | O=C(CC1CSCCN1)N1CCN(C(=O)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClFN3O2S/c18-13-2-1-3-14(19)16(13)17(24)22-7-5-21(6-8-22)15(23)10-12-11-25-9-4-20-12/h1-3,12,20H,4-11H2 |
| InChIKey | ZSBCUJZMSMSUTC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |