C15H21ClN2O — CID 124699273
4-amino-1-[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]butan-1-one (PubChem CID 124699273) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 4-amino-1-[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-amino-1-[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 124699273 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-amino-1-[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]butan-1-one |
| SMILES | NCCCC(=O)N1CCC[C@H]1Cc1ccccc1Cl |
| InChI | InChI=1S/C15H21ClN2O/c16-14-7-2-1-5-12(14)11-13-6-4-10-18(13)15(19)8-3-9-17/h1-2,5,7,13H,3-4,6,8-11,17H2/t13-/m0/s1 |
| InChIKey | GGWJQAMMYZMPMA-ZDUSSCGKSA-N |
| XLogP | 2.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |