C17H23ClN2O3 — CID 166270454
(2S)-2-amino-4-[2-[(2-chlorophenyl)methyl]azepan-1-yl]-4-oxobutanoic acid (PubChem CID 166270454) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is (2S)-2-amino-4-[2-[(2-chlorophenyl)methyl]azepan-1-yl]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[2-[(2-chlorophenyl)methyl]azepan-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 166270454 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2S)-2-amino-4-[2-[(2-chlorophenyl)methyl]azepan-1-yl]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)N1CCCCCC1Cc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C17H23ClN2O3/c18-14-8-4-3-6-12(14)10-13-7-2-1-5-9-20(13)16(21)11-15(19)17(22)23/h3-4,6,8,13,15H,1-2,5,7,9-11,19H2,(H,22,23)/t13?,15-/m0/s1 |
| InChIKey | DXGCSVOZHSHQKK-WUJWULDRSA-N |
| XLogP | 2.46 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |