C20H25ClN2O — CID 94813125
[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone (PubChem CID 94813125) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is [(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone.
| Compound Name | [(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 94813125 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(1-prop-2-ynylpiperidin-4-yl)methanone |
| SMILES | C#CCN1CCC(C(=O)N2CCC[C@H]2Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H25ClN2O/c1-2-11-22-13-9-16(10-14-22)20(24)23-12-5-7-18(23)15-17-6-3-4-8-19(17)21/h1,3-4,6,8,16,18H,5,7,9-15H2/t18-/m0/s1 |
| InChIKey | SIBHTXZZAZRHDN-SFHVURJKSA-N |
| XLogP | 3.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|