C18H17ClN2O3 — CID 60574653
[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 60574653) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 60574653 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCCC1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN2O3/c19-17-6-2-1-4-14(17)12-16-5-3-11-20(16)18(22)13-7-9-15(10-8-13)21(23)24/h1-2,4,6-10,16H,3,5,11-12H2 |
| InChIKey | QMJQJQYWLOOFFM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|