C21H27N2OP — CID 143290719
(3R)-3-amino-1-(2-benzylpyrrolidin-1-yl)-4-(2-phosphanylphenyl)butan-1-one (PubChem CID 143290719) has the molecular formula C21H27N2OP and a molecular weight of 354.43 g/mol. Its IUPAC name is (3R)-3-amino-1-(2-benzylpyrrolidin-1-yl)-4-(2-phosphanylphenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-(2-benzylpyrrolidin-1-yl)-4-(2-phosphanylphenyl)butan-1-one |
|---|---|
| PubChem CID | 143290719 |
| Molecular Formula | C21H27N2OP |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (3R)-3-amino-1-(2-benzylpyrrolidin-1-yl)-4-(2-phosphanylphenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCCC1Cc1ccccc1)Cc1ccccc1P |
| InChI | InChI=1S/C21H27N2OP/c22-18(14-17-9-4-5-11-20(17)25)15-21(24)23-12-6-10-19(23)13-16-7-2-1-3-8-16/h1-5,7-9,11,18-19H,6,10,12-15,22,25H2/t18-,19?/m1/s1 |
| InChIKey | QTJGLGOYAWTJLA-MRTLOADZSA-N |
| XLogP | 2.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|