C18H17ClFNO — CID 94080637
1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone (PubChem CID 94080637) has the molecular formula C18H17ClFNO and a molecular weight of 317.79 g/mol. Its IUPAC name is 1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 94080637 |
| Molecular Formula | C18H17ClFNO |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClFNO/c19-15-8-6-14(7-9-15)17-5-2-10-21(17)18(22)12-13-3-1-4-16(20)11-13/h1,3-4,6-9,11,17H,2,5,10,12H2/t17-/m1/s1 |
| InChIKey | UWEAEPPZVSUFKU-QGZVFWFLSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |