C18H17F2NO — CID 50747082
2-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrrolidin-1-yl]ethanone (PubChem CID 50747082) has the molecular formula C18H17F2NO and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 50747082 |
| Molecular Formula | C18H17F2NO |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F2NO/c19-15-8-6-14(7-9-15)17-5-2-10-21(17)18(22)12-13-3-1-4-16(20)11-13/h1,3-4,6-9,11,17H,2,5,10,12H2 |
| InChIKey | CMGBELYYEXMNRN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |