C19H17Cl2FN2O2 — CID 55613895
N-(3,5-dichlorophenyl)-1-[2-(3-fluorophenyl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 55613895) has the molecular formula C19H17Cl2FN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-[2-(3-fluorophenyl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-1-[2-(3-fluorophenyl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55613895 |
| Molecular Formula | C19H17Cl2FN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-[2-(3-fluorophenyl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C1CCCN1C(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H17Cl2FN2O2/c20-13-9-14(21)11-16(10-13)23-19(26)17-5-2-6-24(17)18(25)8-12-3-1-4-15(22)7-12/h1,3-4,7,9-11,17H,2,5-6,8H2,(H,23,26) |
| InChIKey | WUVULAPPHBESNQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |