C18H25Cl2N3O2 — CID 119731279
1-(7-aminoheptanoyl)-N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide (PubChem CID 119731279) has the molecular formula C18H25Cl2N3O2 and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-(7-aminoheptanoyl)-N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(7-aminoheptanoyl)-N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119731279 |
| Molecular Formula | C18H25Cl2N3O2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-(7-aminoheptanoyl)-N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide |
| SMILES | NCCCCCCC(=O)N1CCCC1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H25Cl2N3O2/c19-13-10-14(20)12-15(11-13)22-18(25)16-6-5-9-23(16)17(24)7-3-1-2-4-8-21/h10-12,16H,1-9,21H2,(H,22,25) |
| InChIKey | OBJNMSADUNNKFI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|