C16H20Cl2N2O2S — CID 55873784
N-(3,5-dichlorophenyl)-1-(2-propylsulfanylacetyl)pyrrolidine-2-carboxamide (PubChem CID 55873784) has the molecular formula C16H20Cl2N2O2S and a molecular weight of 375.32 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-(2-propylsulfanylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-1-(2-propylsulfanylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55873784 |
| Molecular Formula | C16H20Cl2N2O2S |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-(2-propylsulfanylacetyl)pyrrolidine-2-carboxamide |
| SMILES | CCCSCC(=O)N1CCCC1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O2S/c1-2-6-23-10-15(21)20-5-3-4-14(20)16(22)19-13-8-11(17)7-12(18)9-13/h7-9,14H,2-6,10H2,1H3,(H,19,22) |
| InChIKey | YNKCGTDHSOBSTN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|