C16H14BrClN2O — CID 66463523
(6-bromo-3-pyridinyl)-[2-(3-chlorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 66463523) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is (6-bromo-3-pyridinyl)-[2-(3-chlorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (6-bromo-3-pyridinyl)-[2-(3-chlorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 66463523 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (6-bromo-3-pyridinyl)-[2-(3-chlorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)nc1)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14BrClN2O/c17-15-7-6-12(10-19-15)16(21)20-8-2-5-14(20)11-3-1-4-13(18)9-11/h1,3-4,6-7,9-10,14H,2,5,8H2 |
| InChIKey | XGRNBBHBRQVGHS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|