C13H17BrN2O — CID 66465121
(6-bromo-3-pyridinyl)-(2,3-dimethylpiperidin-1-yl)methanone (PubChem CID 66465121) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is (6-bromo-3-pyridinyl)-(2,3-dimethylpiperidin-1-yl)methanone.
| Compound Name | (6-bromo-3-pyridinyl)-(2,3-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 66465121 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (6-bromo-3-pyridinyl)-(2,3-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2ccc(Br)nc2)C1C |
| InChI | InChI=1S/C13H17BrN2O/c1-9-4-3-7-16(10(9)2)13(17)11-5-6-12(14)15-8-11/h5-6,8-10H,3-4,7H2,1-2H3 |
| InChIKey | OWRIMDVSPLULPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|