C14H14BrN3O2 — CID 66465090
(6-bromo-3-pyridinyl)-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methanone (PubChem CID 66465090) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is (6-bromo-3-pyridinyl)-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (6-bromo-3-pyridinyl)-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 66465090 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (6-bromo-3-pyridinyl)-[2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1cc(C2CCCN2C(=O)c2ccc(Br)nc2)on1 |
| InChI | InChI=1S/C14H14BrN3O2/c1-9-7-12(20-17-9)11-3-2-6-18(11)14(19)10-4-5-13(15)16-8-10/h4-5,7-8,11H,2-3,6H2,1H3 |
| InChIKey | WLHHWFKFKNRMMQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|