C16H19N3O2 — CID 110225793
[2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-pyridin-4-ylmethanone (PubChem CID 110225793) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is [2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110225793 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | [2-(3-methyl-1,2-oxazol-5-yl)azepan-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1cc(C2CCCCCN2C(=O)c2ccncc2)on1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-11-15(21-18-12)14-5-3-2-4-10-19(14)16(20)13-6-8-17-9-7-13/h6-9,11,14H,2-5,10H2,1H3 |
| InChIKey | GQVSGBUNIOSQFH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |