C18H23N3O2 — CID 46953255
[2-(5-propyl-1,2-oxazol-3-yl)azepan-1-yl]-pyridin-4-ylmethanone (PubChem CID 46953255) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [2-(5-propyl-1,2-oxazol-3-yl)azepan-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [2-(5-propyl-1,2-oxazol-3-yl)azepan-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 46953255 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [2-(5-propyl-1,2-oxazol-3-yl)azepan-1-yl]-pyridin-4-ylmethanone |
| SMILES | CCCc1cc(C2CCCCCN2C(=O)c2ccncc2)no1 |
| InChI | InChI=1S/C18H23N3O2/c1-2-6-15-13-16(20-23-15)17-7-4-3-5-12-21(17)18(22)14-8-10-19-11-9-14/h8-11,13,17H,2-7,12H2,1H3 |
| InChIKey | NFCLPOZZIUWSJP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |