C23H19N3O5S2 — CID 55626870
ethyl 5-[[4-(pyridin-4-ylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 55626870) has the molecular formula C23H19N3O5S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is ethyl 5-[[4-(pyridin-4-ylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[[4-(pyridin-4-ylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55626870 |
| Molecular Formula | C23H19N3O5S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | ethyl 5-[[4-(pyridin-4-ylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)c3ccc(S(=O)(=O)Nc4ccncc4)cc3)ccc2s1 |
| InChI | InChI=1S/C23H19N3O5S2/c1-2-31-23(28)21-14-16-13-18(5-8-20(16)32-21)25-22(27)15-3-6-19(7-4-15)33(29,30)26-17-9-11-24-12-10-17/h3-14H,2H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | BQNJMCDESXPFPE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |