C21H25N3O4S — CID 49498527
3-(dimethylsulfamoyl)-4-methoxy-N-(1-propylindol-5-yl)benzamide (PubChem CID 49498527) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methoxy-N-(1-propylindol-5-yl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methoxy-N-(1-propylindol-5-yl)benzamide |
|---|---|
| PubChem CID | 49498527 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methoxy-N-(1-propylindol-5-yl)benzamide |
| SMILES | CCCn1ccc2cc(NC(=O)c3ccc(OC)c(S(=O)(=O)N(C)C)c3)ccc21 |
| InChI | InChI=1S/C21H25N3O4S/c1-5-11-24-12-10-15-13-17(7-8-18(15)24)22-21(25)16-6-9-19(28-4)20(14-16)29(26,27)23(2)3/h6-10,12-14H,5,11H2,1-4H3,(H,22,25) |
| InChIKey | YPFKJYWCDRSWKL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |