C29H34N4O7S — CID 46253378
ethyl 4-[5-[[4-(azepan-1-ylsulfonyl)phenyl]carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate (PubChem CID 46253378) has the molecular formula C29H34N4O7S and a molecular weight of 582.68 g/mol. Its IUPAC name is ethyl 4-[5-[[4-(azepan-1-ylsulfonyl)phenyl]carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[[4-(azepan-1-ylsulfonyl)phenyl]carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46253378 |
| Molecular Formula | C29H34N4O7S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | ethyl 4-[5-[[4-(azepan-1-ylsulfonyl)phenyl]carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)c3ccc(C(=O)Nc4ccc(S(=O)(=O)N5CCCCCC5)cc4)cc3C2=O)CC1 |
| InChI | InChI=1S/C29H34N4O7S/c1-2-40-29(37)31-17-13-22(14-18-31)33-27(35)24-12-7-20(19-25(24)28(33)36)26(34)30-21-8-10-23(11-9-21)41(38,39)32-15-5-3-4-6-16-32/h7-12,19,22H,2-6,13-18H2,1H3,(H,30,34) |
| InChIKey | BORDCMXORZPMES-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|