C18H25N3O5 — CID 109003771
ethyl 4-[[2-(3-methoxycarbonylanilino)acetyl]amino]piperidine-1-carboxylate (PubChem CID 109003771) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is ethyl 4-[[2-(3-methoxycarbonylanilino)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(3-methoxycarbonylanilino)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109003771 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | ethyl 4-[[2-(3-methoxycarbonylanilino)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CNc2cccc(C(=O)OC)c2)CC1 |
| InChI | InChI=1S/C18H25N3O5/c1-3-26-18(24)21-9-7-14(8-10-21)20-16(22)12-19-15-6-4-5-13(11-15)17(23)25-2/h4-6,11,14,19H,3,7-10,12H2,1-2H3,(H,20,22) |
| InChIKey | DZTMQAOYGQJCGV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |