C19H22FN5O3 — CID 109286246
ethyl 4-[[5-[(2-fluorophenyl)carbamoyl]pyrazin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 109286246) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is ethyl 4-[[5-[(2-fluorophenyl)carbamoyl]pyrazin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-[(2-fluorophenyl)carbamoyl]pyrazin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109286246 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl 4-[[5-[(2-fluorophenyl)carbamoyl]pyrazin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cnc(C(=O)Nc3ccccc3F)cn2)CC1 |
| InChI | InChI=1S/C19H22FN5O3/c1-2-28-19(27)25-9-7-13(8-10-25)23-17-12-21-16(11-22-17)18(26)24-15-6-4-3-5-14(15)20/h3-6,11-13H,2,7-10H2,1H3,(H,22,23)(H,24,26) |
| InChIKey | RNOPOFQVDDKHTB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |