C16H18N4O — CID 109271849
5-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide (PubChem CID 109271849) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109271849 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cnc(NC3CC3)cn2)c1C |
| InChI | InChI=1S/C16H18N4O/c1-10-4-3-5-13(11(10)2)20-16(21)14-8-18-15(9-17-14)19-12-6-7-12/h3-5,8-9,12H,6-7H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | RRBYRCJKKSNSNP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |