C20H26N4O — CID 109287578
5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide (PubChem CID 109287578) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287578 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyrazine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cnc(NC3CCCCCC3)cn2)c1C |
| InChI | InChI=1S/C20H26N4O/c1-14-8-7-11-17(15(14)2)24-20(25)18-12-22-19(13-21-18)23-16-9-5-3-4-6-10-16/h7-8,11-13,16H,3-6,9-10H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | FMXZGFCMZYPNPN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |