C21H27N3O — CID 109195369
5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide (PubChem CID 109195369) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide.
| Compound Name | 5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109195369 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 5-(cycloheptylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(NC3CCCCCC3)cn2)c1C |
| InChI | InChI=1S/C21H27N3O/c1-15-8-7-11-19(16(15)2)24-21(25)20-13-12-18(14-22-20)23-17-9-5-3-4-6-10-17/h7-8,11-14,17,23H,3-6,9-10H2,1-2H3,(H,24,25) |
| InChIKey | JLCOYQJBIMPHDR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |