C17H19N3O — CID 109201977
4-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide (PubChem CID 109201977) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109201977 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 4-(cyclopropylamino)-N-(2,3-dimethylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(NC3CC3)ccn2)c1C |
| InChI | InChI=1S/C17H19N3O/c1-11-4-3-5-15(12(11)2)20-17(21)16-10-14(8-9-18-16)19-13-6-7-13/h3-5,8-10,13H,6-7H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | JBZREPLPLKWQMN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |