C21H27N5O3 — CID 109280917
ethyl 4-[[5-(1-phenylethylamino)pyrazine-2-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109280917) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl 4-[[5-(1-phenylethylamino)pyrazine-2-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(1-phenylethylamino)pyrazine-2-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109280917 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | ethyl 4-[[5-(1-phenylethylamino)pyrazine-2-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cnc(NC(C)c3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-3-29-21(28)26-11-9-17(10-12-26)25-20(27)18-13-23-19(14-22-18)24-15(2)16-7-5-4-6-8-16/h4-8,13-15,17H,3,9-12H2,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | CWKNNVPNPILIAI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |