About 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide
2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide (PubChem CID 108925288) has the molecular formula C27H24N4O4
and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide |
| PubChem CID | 108925288 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1NC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)c1cccnc1 |
| InChI | InChI=1S/C27H24N4O4/c32-24(29-22-10-4-5-11-23(22)30-25(33)18-7-6-14-28-16-18)17-12-13-20-21(15-17)27(35)31(26(20)34)19-8-2-1-3-9-19/h4-7,10-16,19H,1-3,8-9H2,(H,29,32)(H,30,33) |
| InChIKey | YNZTWGLMIMQXSI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide?
The IUPAC name of 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide (CID 108925288) is 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide.
What is the SMILES notation for 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide?
The canonical SMILES for 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide is O=C(Nc1ccccc1NC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)c1cccnc1.
What is the InChIKey of 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide?
The InChIKey is YNZTWGLMIMQXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N4O4/c32-24(29-22-10-4-5-11-23(22)30-25(33)18-7-6-14-28-16-18)17-12-13-20-21(15-17)27(35)31(26(20)34)19-8-2-1-3-9-19/h4-7,10-16,19H,1-3,8-9H2,(H,29,32)(H,30,33).
What are the key properties of 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide?
2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide has a molecular weight of 468.51 g/mol, XLogP of 4.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,3-dioxo-N-[2-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide is sourced from PubChem (CID 108925288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).