C23H22N2O6 — CID 108764239
2-[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-hydroxyphenyl]acetic acid (PubChem CID 108764239) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 108764239 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]-4-hydroxyphenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(O)c(NC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c1 |
| InChI | InChI=1S/C23H22N2O6/c26-19-9-6-13(11-20(27)28)10-18(19)24-21(29)14-7-8-16-17(12-14)23(31)25(22(16)30)15-4-2-1-3-5-15/h6-10,12,15,26H,1-5,11H2,(H,24,29)(H,27,28) |
| InChIKey | VLBMJVGGLQAFCF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|