C26H20N4O9 — CID 108931020
ethyl [4-[[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931020) has the molecular formula C26H20N4O9 and a molecular weight of 532.47 g/mol. Its IUPAC name is ethyl [4-[[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931020 |
| Molecular Formula | C26H20N4O9 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | ethyl [4-[[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C26H20N4O9/c1-2-38-26(35)39-17-10-7-15(8-11-17)23(32)28-21-6-4-3-5-20(21)27-22(31)14-29-24(33)18-12-9-16(30(36)37)13-19(18)25(29)34/h3-13H,2,14H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | BQKOUCUSJHEGPW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|