C17H14N6O — CID 168608920
2-[[1-(oxan-2-yl)indazol-7-yl]amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608920) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[[1-(oxan-2-yl)indazol-7-yl]amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[[1-(oxan-2-yl)indazol-7-yl]amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608920 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[[1-(oxan-2-yl)indazol-7-yl]amino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc2cnn(C3CCCCO3)c12 |
| InChI | InChI=1S/C17H14N6O/c18-8-13(9-19)15(10-20)22-14-5-3-4-12-11-21-23(17(12)14)16-6-1-2-7-24-16/h3-5,11,16,22H,1-2,6-7H2 |
| InChIKey | HHSLUNNUBNNXRV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|