C20H24N2O4 — CID 146380372
1-[6-methyl-1-(oxan-2-yl)indazol-7-yl]-2-oxocyclohexane-1-carboxylic acid (PubChem CID 146380372) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[6-methyl-1-(oxan-2-yl)indazol-7-yl]-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | 1-[6-methyl-1-(oxan-2-yl)indazol-7-yl]-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 146380372 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[6-methyl-1-(oxan-2-yl)indazol-7-yl]-2-oxocyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc2cnn(C3CCCCO3)c2c1C1(C(=O)O)CCCCC1=O |
| InChI | InChI=1S/C20H24N2O4/c1-13-8-9-14-12-21-22(16-7-3-5-11-26-16)18(14)17(13)20(19(24)25)10-4-2-6-15(20)23/h8-9,12,16H,2-7,10-11H2,1H3,(H,24,25) |
| InChIKey | HPXJFFILVXYORO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|