C18H25N3O4 — CID 171597592
tert-butyl N-[7-methoxy-1-(oxan-2-yl)indazol-6-yl]carbamate (PubChem CID 171597592) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[7-methoxy-1-(oxan-2-yl)indazol-6-yl]carbamate.
| Compound Name | tert-butyl N-[7-methoxy-1-(oxan-2-yl)indazol-6-yl]carbamate |
|---|---|
| PubChem CID | 171597592 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-[7-methoxy-1-(oxan-2-yl)indazol-6-yl]carbamate |
| SMILES | COc1c(NC(=O)OC(C)(C)C)ccc2cnn(C3CCCCO3)c12 |
| InChI | InChI=1S/C18H25N3O4/c1-18(2,3)25-17(22)20-13-9-8-12-11-19-21(15(12)16(13)23-4)14-7-5-6-10-24-14/h8-9,11,14H,5-7,10H2,1-4H3,(H,20,22) |
| InChIKey | NVMMVEWEPVOHDZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |