C15H19F2N3O3 — CID 171437057
tert-butyl N-[1-(2,2-difluoroethyl)-7-methoxyindazol-6-yl]carbamate (PubChem CID 171437057) has the molecular formula C15H19F2N3O3 and a molecular weight of 327.33 g/mol. Its IUPAC name is tert-butyl N-[1-(2,2-difluoroethyl)-7-methoxyindazol-6-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,2-difluoroethyl)-7-methoxyindazol-6-yl]carbamate |
|---|---|
| PubChem CID | 171437057 |
| Molecular Formula | C15H19F2N3O3 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | tert-butyl N-[1-(2,2-difluoroethyl)-7-methoxyindazol-6-yl]carbamate |
| SMILES | COc1c(NC(=O)OC(C)(C)C)ccc2cnn(CC(F)F)c12 |
| InChI | InChI=1S/C15H19F2N3O3/c1-15(2,3)23-14(21)19-10-6-5-9-7-18-20(8-11(16)17)12(9)13(10)22-4/h5-7,11H,8H2,1-4H3,(H,19,21) |
| InChIKey | UFBQVWCBPISUNZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |