C13H11N5O4S — CID 172980133
4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-hydroxynaphthalene-1-sulfonic acid (PubChem CID 172980133) has the molecular formula C13H11N5O4S and a molecular weight of 333.33 g/mol. Its IUPAC name is 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 172980133 |
| Molecular Formula | C13H11N5O4S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-hydroxynaphthalene-1-sulfonic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C13H11N5O4S/c14-6-9(13(15)16)17-18-12-8-4-2-1-3-7(8)11(5-10(12)19)23(20,21)22/h1-5,18-19H,(H3,15,16)(H,20,21,22)/b17-9+ |
| InChIKey | ZEOZTPINVIDIQT-RQZCQDPDSA-N |
| XLogP | 1.02 |
| TPSA | 172.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|