C15H10Cl2N6O3S — CID 172978935
8-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,6-dichloro-9H-carbazole-1-sulfonic acid (PubChem CID 172978935) has the molecular formula C15H10Cl2N6O3S and a molecular weight of 425.26 g/mol. Its IUPAC name is 8-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,6-dichloro-9H-carbazole-1-sulfonic acid.
| Compound Name | 8-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,6-dichloro-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 172978935 |
| Molecular Formula | C15H10Cl2N6O3S |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | 8-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,6-dichloro-9H-carbazole-1-sulfonic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(Cl)cc2c1[nH]c1c(S(=O)(=O)O)cc(Cl)cc12 |
| InChI | InChI=1S/C15H10Cl2N6O3S/c16-6-1-8-9-2-7(17)4-12(27(24,25)26)14(9)21-13(8)10(3-6)22-23-11(5-18)15(19)20/h1-4,21-22H,(H3,19,20)(H,24,25,26)/b23-11+ |
| InChIKey | MAOWZBXBSSMCLT-FOKLQQMPSA-N |
| XLogP | 3.10 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|