C15H7Cl2N5O3S — CID 169340588
3,6-dichloro-8-[2-(dicyanomethylidene)hydrazinyl]-9H-carbazole-1-sulfonic acid (PubChem CID 169340588) has the molecular formula C15H7Cl2N5O3S and a molecular weight of 408.23 g/mol. Its IUPAC name is 3,6-dichloro-8-[2-(dicyanomethylidene)hydrazinyl]-9H-carbazole-1-sulfonic acid.
| Compound Name | 3,6-dichloro-8-[2-(dicyanomethylidene)hydrazinyl]-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 169340588 |
| Molecular Formula | C15H7Cl2N5O3S |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 3,6-dichloro-8-[2-(dicyanomethylidene)hydrazinyl]-9H-carbazole-1-sulfonic acid |
| SMILES | N#CC(C#N)=NNc1cc(Cl)cc2c1[nH]c1c(S(=O)(=O)O)cc(Cl)cc12 |
| InChI | InChI=1S/C15H7Cl2N5O3S/c16-7-1-10-11-2-8(17)4-13(26(23,24)25)15(11)20-14(10)12(3-7)22-21-9(5-18)6-19/h1-4,20,22H,(H,23,24,25) |
| InChIKey | LTXYUYXNLDLPOG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|