C20H10Cl2N2O5S — CID 168518715
3,6-dichloro-8-(1,3-dioxoisoindol-2-yl)-9H-carbazole-1-sulfonic acid (PubChem CID 168518715) has the molecular formula C20H10Cl2N2O5S and a molecular weight of 461.28 g/mol. Its IUPAC name is 3,6-dichloro-8-(1,3-dioxoisoindol-2-yl)-9H-carbazole-1-sulfonic acid.
| Compound Name | 3,6-dichloro-8-(1,3-dioxoisoindol-2-yl)-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 168518715 |
| Molecular Formula | C20H10Cl2N2O5S |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | 3,6-dichloro-8-(1,3-dioxoisoindol-2-yl)-9H-carbazole-1-sulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(Cl)cc2c1[nH]c1c(S(=O)(=O)O)cc(Cl)cc12 |
| InChI | InChI=1S/C20H10Cl2N2O5S/c21-9-5-13-14-6-10(22)8-16(30(27,28)29)18(14)23-17(13)15(7-9)24-19(25)11-3-1-2-4-12(11)20(24)26/h1-8,23H,(H,27,28,29) |
| InChIKey | WUGGUBRANIEWGO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|