C18H13Cl2N3O6S — CID 168558305
3,6-dichloro-8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-9H-carbazole-1-sulfonic acid (PubChem CID 168558305) has the molecular formula C18H13Cl2N3O6S and a molecular weight of 470.29 g/mol. Its IUPAC name is 3,6-dichloro-8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-9H-carbazole-1-sulfonic acid.
| Compound Name | 3,6-dichloro-8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 168558305 |
| Molecular Formula | C18H13Cl2N3O6S |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 3,6-dichloro-8-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-9H-carbazole-1-sulfonic acid |
| SMILES | O=C1C=C(Nc2cc(Cl)cc3c2[nH]c2c(S(=O)(=O)O)cc(Cl)cc23)C(=O)N1CCO |
| InChI | InChI=1S/C18H13Cl2N3O6S/c19-8-3-10-11-4-9(20)6-14(30(27,28)29)17(11)22-16(10)12(5-8)21-13-7-15(25)23(1-2-24)18(13)26/h3-7,21-22,24H,1-2H2,(H,27,28,29) |
| InChIKey | JYLDBGPPNCQARX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|