C17H24Cl2N6O2S — CID 172978902
(1Z)-2-amino-N-[2,5-dichloro-4-(dibutylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978902) has the molecular formula C17H24Cl2N6O2S and a molecular weight of 447.39 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2,5-dichloro-4-(dibutylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2,5-dichloro-4-(dibutylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978902 |
| Molecular Formula | C17H24Cl2N6O2S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (1Z)-2-amino-N-[2,5-dichloro-4-(dibutylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(Cl)c(S(=O)(=O)N(CCCC)CCCC)cc1Cl |
| InChI | InChI=1S/C17H24Cl2N6O2S/c1-3-5-7-25(8-6-4-2)28(26,27)16-10-12(18)14(9-13(16)19)23-24-15(11-20)17(21)22/h9-10,23H,3-8H2,1-2H3,(H3,21,22)/b24-15+ |
| InChIKey | NRLBPBFIGTUAES-BUVRLJJBSA-N |
| XLogP | 3.81 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|