C17H27Cl3N2O3S — CID 168639504
N,N-dibutyl-2,5-dichloro-4-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonamide (PubChem CID 168639504) has the molecular formula C17H27Cl3N2O3S and a molecular weight of 445.84 g/mol. Its IUPAC name is N,N-dibutyl-2,5-dichloro-4-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonamide.
| Compound Name | N,N-dibutyl-2,5-dichloro-4-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 168639504 |
| Molecular Formula | C17H27Cl3N2O3S |
| Molecular Weight | 445.84 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | N,N-dibutyl-2,5-dichloro-4-[(3-chloro-2-hydroxypropyl)amino]benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1cc(Cl)c(NCC(O)CCl)cc1Cl |
| InChI | InChI=1S/C17H27Cl3N2O3S/c1-3-5-7-22(8-6-4-2)26(24,25)17-10-14(19)16(9-15(17)20)21-12-13(23)11-18/h9-10,13,21,23H,3-8,11-12H2,1-2H3 |
| InChIKey | YTUCVXLCAJIWMY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|