C17H10BrN5O3 — CID 172980034
(1Z)-2-amino-N-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-iminoethanimidoyl cyanide (PubChem CID 172980034) has the molecular formula C17H10BrN5O3 and a molecular weight of 412.20 g/mol. Its IUPAC name is (1Z)-2-amino-N-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980034 |
| Molecular Formula | C17H10BrN5O3 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | (1Z)-2-amino-N-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Br)cc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H10BrN5O3/c18-9-5-11(24)12-13(14(9)23-22-10(6-19)17(20)21)16(26)8-4-2-1-3-7(8)15(12)25/h1-5,23-24H,(H3,20,21)/b22-10+ |
| InChIKey | REJMPMQMYNHAKP-LSHDLFTRSA-N |
| XLogP | 2.16 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|