C17H10N5O7S- — CID 172977270
4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate (PubChem CID 172977270) has the molecular formula C17H10N5O7S- and a molecular weight of 428.36 g/mol. Its IUPAC name is 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 172977270 |
| Molecular Formula | C17H10N5O7S- |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(O)c(S(=O)(=O)[O-])c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11N5O7S/c18-5-8(17(19)20)21-22-11-9-10(14(25)16(15(11)26)30(27,28)29)13(24)7-4-2-1-3-6(7)12(9)23/h1-4,22,25-26H,(H3,19,20)(H,27,28,29)/p-1/b21-8+ |
| InChIKey | IRPRESUTMOFKTN-ODCIPOBUSA-M |
| XLogP | 0.00 |
| TPSA | 229.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|