About CID 71299271
CID 71299271 (PubChem CID 71299271) has the molecular formula C14H10N2O7S
and a molecular weight of 350.31 g/mol.
Molecular Properties
| Compound Name | CID 71299271 |
| PubChem CID | 71299271 |
| Molecular Formula | C14H10N2O7S |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | — |
| SMILES | Nc1c(O)c(S(=O)(=O)[O-])c(O)c2c1C(=O)c1ccccc1C2=O.[NH2+] |
| InChI | InChI=1S/C14H9NO7S.H2N/c15-9-7-8(12(18)14(13(9)19)23(20,21)22)11(17)6-4-2-1-3-5(6)10(7)16;/h1-4,18-19H,15H2,(H,20,21,22);1H2/q;+1/p-1 |
| InChIKey | HNOPAMCBBABSLD-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 191.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 71299271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71299271?
The IUPAC name of CID 71299271 (CID 71299271) is not available.
What is the SMILES notation for CID 71299271?
The canonical SMILES for CID 71299271 is Nc1c(O)c(S(=O)(=O)[O-])c(O)c2c1C(=O)c1ccccc1C2=O.[NH2+].
What is the InChIKey of CID 71299271?
The InChIKey is HNOPAMCBBABSLD-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H9NO7S.H2N/c15-9-7-8(12(18)14(13(9)19)23(20,21)22)11(17)6-4-2-1-3-5(6)10(7)16;/h1-4,18-19H,15H2,(H,20,21,22);1H2/q;+1/p-1.
What are the key properties of CID 71299271?
CID 71299271 has a molecular weight of 350.31 g/mol, XLogP of -1.16, 1 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71299271 is sourced from PubChem (CID 71299271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).