C14H10N2O7S — CID 71299271
CID 71299271 (PubChem CID 71299271) has the molecular formula C14H10N2O7S and a molecular weight of 350.31 g/mol.
| Compound Name | CID 71299271 |
|---|---|
| PubChem CID | 71299271 |
| Molecular Formula | C14H10N2O7S |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | — |
| SMILES | Nc1c(O)c(S(=O)(=O)[O-])c(O)c2c1C(=O)c1ccccc1C2=O.[NH2+] |
| InChI | InChI=1S/C14H9NO7S.H2N/c15-9-7-8(12(18)14(13(9)19)23(20,21)22)11(17)6-4-2-1-3-5(6)10(7)16;/h1-4,18-19H,15H2,(H,20,21,22);1H2/q;+1/p-1 |
| InChIKey | HNOPAMCBBABSLD-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 191.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|