C22H10NO9S- — CID 168517206
4-(1,3-dioxoisoindol-2-yl)-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate (PubChem CID 168517206) has the molecular formula C22H10NO9S- and a molecular weight of 464.39 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 168517206 |
| Molecular Formula | C22H10NO9S- |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(O)c(S(=O)(=O)[O-])c(O)c2N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H11NO9S/c24-16-9-5-1-2-6-10(9)17(25)14-13(16)15(19(27)20(18(14)26)33(30,31)32)23-21(28)11-7-3-4-8-12(11)22(23)29/h1-8,26-27H,(H,30,31,32)/p-1 |
| InChIKey | QPPRNPCFSLXJCQ-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|